Back
| Product Name | Bisacrylamide |
| Used For | Molecular biology studies |
| Molecular Weight | 154.17 g/mol |
| Chemical Formula | C7H10N2O4 |
| Appearance | White crystalline powder |
| Solubility | Soluble in water |
| Storage Temperature | Room temperature |
| Purity | ≥98% |
| Melting Point | 173-175°C |
| Boiling Point | 398.3°C |
| Flash Point | 207.2°C |
| Density | 1.307 g/cm3 |
| CAS Number | 110-26-9 |
| PubChem CID | 178740 |
| SMILES | CC(=O)N(C1=CC=C(C=C1)O)C=C |
| InChI | 1S/C7H10N2O4/c1-4(10)7(13)9-5-2-3-6(11)8-5/h2-3,5H,1H3,(H,8,11)(H,9,13) |
FAQ
What is Bisacrylamide used for in molecular biology?
Bisacrylamide is commonly used in molecular biology as a crosslinking agent for polyacrylamide gels. It helps to strengthen the gel matrix and improve the resolution of DNA, RNA, and proteins during electrophoresis.
How does Bisacrylamide work in polyacrylamide gel electrophoresis (PAGE)?
Bisacrylamide works by reacting with acrylamide monomers to form crosslinks between polymer chains. This crosslinking creates a stable gel matrix through which molecules can migrate under an electric field during electrophoresis.
What are the advantages of using Bisacrylamide in molecular biology applications?
One of the main advantages of using Bisacrylamide is its ability to control the pore size of the gel matrix, which can be adjusted by varying the concentration of Bisacrylamide in the gel. This allows for precise separation of molecules based on their size.
Are there any safety considerations when working with Bisacrylamide?
Yes, caution should be taken when handling Bisacrylamide as it is considered to be a potential carcinogen and can be toxic if ingested or inhaled. It is important to use proper personal protective equipment, such as gloves and a lab coat, when working with Bisacrylamide.
How should Bisacrylamide be stored to maintain its stability?
Bisacrylamide should be stored in a cool, dry place away from light and moisture to prevent degradation. It is recommended to store Bisacrylamide in a tightly sealed container at room temperature or below to maintain its stability over time.
Bisacrylamide is commonly used in molecular biology as a crosslinking agent for polyacrylamide gels. It helps to strengthen the gel matrix and improve the resolution of DNA, RNA, and proteins during electrophoresis.
How does Bisacrylamide work in polyacrylamide gel electrophoresis (PAGE)?
Bisacrylamide works by reacting with acrylamide monomers to form crosslinks between polymer chains. This crosslinking creates a stable gel matrix through which molecules can migrate under an electric field during electrophoresis.
What are the advantages of using Bisacrylamide in molecular biology applications?
One of the main advantages of using Bisacrylamide is its ability to control the pore size of the gel matrix, which can be adjusted by varying the concentration of Bisacrylamide in the gel. This allows for precise separation of molecules based on their size.
Are there any safety considerations when working with Bisacrylamide?
Yes, caution should be taken when handling Bisacrylamide as it is considered to be a potential carcinogen and can be toxic if ingested or inhaled. It is important to use proper personal protective equipment, such as gloves and a lab coat, when working with Bisacrylamide.
How should Bisacrylamide be stored to maintain its stability?
Bisacrylamide should be stored in a cool, dry place away from light and moisture to prevent degradation. It is recommended to store Bisacrylamide in a tightly sealed container at room temperature or below to maintain its stability over time.
