Back
| Name | D(+)-Sucrose |
| Type | Molecular biology product |
| Purity | ≥99% |
| Form | Powder |
| Solubility | Soluble in water |
| Storage | Store at room temperature |
| CAS Number | 57-50-1 |
| Molecular Formula | C12H22O11 |
| Molecular Weight | 342.30 g/mol |
| Boiling Point | 1,610 °C |
| Melting Point | 185-186 °C |
| Appearance | White to off-white powder |
| Specific Rotation | +66.5 to +68.5 degrees (c=20, water) |
| Density | 1.587 g/cm3 |
| PubChem CID | 5988 |
| SMILES | O[C@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@H](O1)CO |
FAQ
What is D(+) Sucrose?
D(+) Sucrose is a common disaccharide composed of glucose and fructose that is widely used in molecular biology applications. It is often used as a carbon source in various cell culture and fermentation processes.
How is D(+) Sucrose used in molecular biology?
D(+) Sucrose is commonly used in molecular biology for the isolation of intact chloroplasts, mitochondria, and other subcellular organelles. It is also used in nucleic acid extraction and purification procedures.
What are the advantages of using D(+) Sucrose in molecular biology?
D(+) Sucrose is preferred for biomolecular applications due to its high solubility, stability, and compatibility with various biological samples. It is also non-toxic to cells and does not interfere with enzymatic reactions commonly used in molecular biology.
Can D(+) Sucrose be used in other applications outside of molecular biology?
While D(+) Sucrose is primarily used in molecular biology, it also has various applications in food, pharmaceutical, and cosmetic industries. It is commonly used as a sweetening agent, stabilizer, and osmotic pressure regulator in these industries.
Are there any precautions to consider when using D(+) Sucrose in molecular biology experiments?
It is essential to store D(+) Sucrose in a dry and cool environment to prevent degradation. Additionally, the purity of the sucrose should be verified to minimize the risk of contamination in experimental procedures.
D(+) Sucrose is a common disaccharide composed of glucose and fructose that is widely used in molecular biology applications. It is often used as a carbon source in various cell culture and fermentation processes.
How is D(+) Sucrose used in molecular biology?
D(+) Sucrose is commonly used in molecular biology for the isolation of intact chloroplasts, mitochondria, and other subcellular organelles. It is also used in nucleic acid extraction and purification procedures.
What are the advantages of using D(+) Sucrose in molecular biology?
D(+) Sucrose is preferred for biomolecular applications due to its high solubility, stability, and compatibility with various biological samples. It is also non-toxic to cells and does not interfere with enzymatic reactions commonly used in molecular biology.
Can D(+) Sucrose be used in other applications outside of molecular biology?
While D(+) Sucrose is primarily used in molecular biology, it also has various applications in food, pharmaceutical, and cosmetic industries. It is commonly used as a sweetening agent, stabilizer, and osmotic pressure regulator in these industries.
Are there any precautions to consider when using D(+) Sucrose in molecular biology experiments?
It is essential to store D(+) Sucrose in a dry and cool environment to prevent degradation. Additionally, the purity of the sucrose should be verified to minimize the risk of contamination in experimental procedures.
