Back
| Name | Indigo Carmine (C.I. 73015) |
| Color | Blue |
| Chemical Formula | C16H8N2Na2O8S2 |
| Solubility | Soluble in water |
| Usage | Clinical diagnosis product |
| Molar Mass | 466.36 g/mol |
| Melting Point | 240-242°C |
| Boiling Point | Decomposes |
| Odor | Odorless |
| PH Range | 11.0 - 13.0 |
| Storage Conditions | Store in a cool, dry place away from heat and light |
| Specific Gravity | 1.58 |
| Chemical Name | Disodium indigotindisulfonate |
| Pubchem Cid | 5368434 |
| Smiles Notation | C1=CC2=C(C=C1S(=O)(=O)[O-])C(=NN=C2N)S(=O)(=O)[O-].[Na+].[Na+] |
| Cas Number | 860-22-0 |
FAQ
What is Indigo Carmine (C.I. 73015) and how is it used in clinical diagnosis?
Indigo Carmine, also known as C.I. 73015, is a synthetic dye that is commonly used in medical procedures for diagnostic purposes. It is commonly used as a contrast agent in imaging studies, such as X-rays, to help visualize the anatomy and function of organs in the body.
How does Indigo Carmine work in clinical diagnosis?
Indigo Carmine works by highlighting specific structures or areas of interest in the body to aid in the diagnosis of various medical conditions. When injected into the bloodstream or taken orally, Indigo Carmine can be visualized using imaging techniques, allowing healthcare providers to assess the function and integrity of different organs or systems within the body.
What are some common medical procedures that use Indigo Carmine for clinical diagnosis?
Indigo Carmine is commonly used in procedures such as cystoscopy, where it is used to help identify abnormalities in the urinary tract, as well as in endoscopic procedures to visualize the gastrointestinal tract. It is also used in certain surgical procedures to aid in the identification of specific structures or tissues within the body.
Are there any risks or side effects associated with the use of Indigo Carmine for clinical diagnosis?
While Indigo Carmine is generally considered safe for use in medical procedures, there are some potential risks and side effects to be aware of. These may include allergic reactions, nausea, vomiting, and rare cases of anaphylaxis. It is important for healthcare providers to carefully assess each patient's medical history and potential risks before using Indigo Carmine for diagnostic purposes.
How can healthcare providers ensure the safe and effective use of Indigo Carmine in clinical diagnosis?
Healthcare providers should carefully follow the recommended dosage and administration guidelines for Indigo Carmine to ensure patient safety and optimal diagnostic results. In addition, patients should be informed of the potential risks and side effects associated with Indigo Carmine use, and any concerns or adverse reactions should be reported to the healthcare provider immediately.
Indigo Carmine, also known as C.I. 73015, is a synthetic dye that is commonly used in medical procedures for diagnostic purposes. It is commonly used as a contrast agent in imaging studies, such as X-rays, to help visualize the anatomy and function of organs in the body.
How does Indigo Carmine work in clinical diagnosis?
Indigo Carmine works by highlighting specific structures or areas of interest in the body to aid in the diagnosis of various medical conditions. When injected into the bloodstream or taken orally, Indigo Carmine can be visualized using imaging techniques, allowing healthcare providers to assess the function and integrity of different organs or systems within the body.
What are some common medical procedures that use Indigo Carmine for clinical diagnosis?
Indigo Carmine is commonly used in procedures such as cystoscopy, where it is used to help identify abnormalities in the urinary tract, as well as in endoscopic procedures to visualize the gastrointestinal tract. It is also used in certain surgical procedures to aid in the identification of specific structures or tissues within the body.
Are there any risks or side effects associated with the use of Indigo Carmine for clinical diagnosis?
While Indigo Carmine is generally considered safe for use in medical procedures, there are some potential risks and side effects to be aware of. These may include allergic reactions, nausea, vomiting, and rare cases of anaphylaxis. It is important for healthcare providers to carefully assess each patient's medical history and potential risks before using Indigo Carmine for diagnostic purposes.
How can healthcare providers ensure the safe and effective use of Indigo Carmine in clinical diagnosis?
Healthcare providers should carefully follow the recommended dosage and administration guidelines for Indigo Carmine to ensure patient safety and optimal diagnostic results. In addition, patients should be informed of the potential risks and side effects associated with Indigo Carmine use, and any concerns or adverse reactions should be reported to the healthcare provider immediately.